C11H18N4 — CID 105459542
2-(2-aminopropyl)-5,6,7,8-tetrahydroquinazolin-4-amine (PubChem CID 105459542) has the molecular formula C11H18N4 and a molecular weight of 206.29 g/mol. Its IUPAC name is 2-(2-aminopropyl)-5,6,7,8-tetrahydroquinazolin-4-amine.
| Compound Name | 2-(2-aminopropyl)-5,6,7,8-tetrahydroquinazolin-4-amine |
|---|---|
| PubChem CID | 105459542 |
| Molecular Formula | C11H18N4 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | 2-(2-aminopropyl)-5,6,7,8-tetrahydroquinazolin-4-amine |
| SMILES | CC(N)Cc1nc(N)c2c(n1)CCCC2 |
| InChI | InChI=1S/C11H18N4/c1-7(12)6-10-14-9-5-3-2-4-8(9)11(13)15-10/h7H,2-6,12H2,1H3,(H2,13,14,15) |
| InChIKey | DYLCCSFATRJQBT-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |