C21H40O2Si — CID 10545962
(2S,3R,4aS,5S,8aR)-5-[tert-butyl(dimethyl)silyl]oxy-2,3,4a,7,7-pentamethyl-3,4,5,6,8,8a-hexahydro-2H-naphthalen-1-one (PubChem CID 10545962) has the molecular formula C21H40O2Si and a molecular weight of 352.64 g/mol. Its IUPAC name is (2S,3R,4aS,5S,8aR)-5-[tert-butyl(dimethyl)silyl]oxy-2,3,4a,7,7-pentamethyl-3,4,5,6,8,8a-hexahydro-2H-naphthalen-1-one.
| Compound Name | (2S,3R,4aS,5S,8aR)-5-[tert-butyl(dimethyl)silyl]oxy-2,3,4a,7,7-pentamethyl-3,4,5,6,8,8a-hexahydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 10545962 |
| Molecular Formula | C21H40O2Si |
| Molecular Weight | 352.64 g/mol |
| Exact Mass | 352.28 |
| IUPAC Name | (2S,3R,4aS,5S,8aR)-5-[tert-butyl(dimethyl)silyl]oxy-2,3,4a,7,7-pentamethyl-3,4,5,6,8,8a-hexahydro-2H-naphthalen-1-one |
| SMILES | C[C@@H]1C[C@]2(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC(C)(C)C[C@H]2C(=O)[C@H]1C |
| InChI | InChI=1S/C21H40O2Si/c1-14-11-21(8)16(18(22)15(14)2)12-20(6,7)13-17(21)23-24(9,10)19(3,4)5/h14-17H,11-13H2,1-10H3/t14-,15+,16+,17+,21+/m1/s1 |
| InChIKey | BEPYKFZOTJVYMG-RZSFDFLPSA-N |
| XLogP | 6.06 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.64 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|