About 5-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]indol-2-amine
5-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]indol-2-amine (PubChem CID 105459775) has the molecular formula C11H11ClN2
and a molecular weight of 206.68 g/mol. Its IUPAC name is 5-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]indol-2-amine.
Molecular Properties
| Compound Name | 5-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]indol-2-amine |
| PubChem CID | 105459775 |
| Molecular Formula | C11H11ClN2 |
| Molecular Weight | 206.68 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | 5-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]indol-2-amine |
| SMILES | NC1Cc2cc3c(Cl)cccc3n2C1 |
| InChI | InChI=1S/C11H11ClN2/c12-10-2-1-3-11-9(10)5-8-4-7(13)6-14(8)11/h1-3,5,7H,4,6,13H2 |
| InChIKey | WSNBEPGSYUGGIN-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.68 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]indol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]indol-2-amine?
The IUPAC name of 5-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]indol-2-amine (CID 105459775) is 5-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]indol-2-amine.
What is the SMILES notation for 5-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]indol-2-amine?
The canonical SMILES for 5-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]indol-2-amine is NC1Cc2cc3c(Cl)cccc3n2C1.
What is the InChIKey of 5-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]indol-2-amine?
The InChIKey is WSNBEPGSYUGGIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11ClN2/c12-10-2-1-3-11-9(10)5-8-4-7(13)6-14(8)11/h1-3,5,7H,4,6,13H2.
What are the key properties of 5-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]indol-2-amine?
5-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]indol-2-amine has a molecular weight of 206.68 g/mol, XLogP of 2.18, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]indol-2-amine is sourced from PubChem (CID 105459775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).