About 2-(5-cyclobutyl-1,2,4-triazin-3-yl)propanoic acid
2-(5-cyclobutyl-1,2,4-triazin-3-yl)propanoic acid (PubChem CID 105460244) has the molecular formula C10H13N3O2
and a molecular weight of 207.23 g/mol. Its IUPAC name is 2-(5-cyclobutyl-1,2,4-triazin-3-yl)propanoic acid.
Molecular Properties
| Compound Name | 2-(5-cyclobutyl-1,2,4-triazin-3-yl)propanoic acid |
| PubChem CID | 105460244 |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | 2-(5-cyclobutyl-1,2,4-triazin-3-yl)propanoic acid |
| SMILES | CC(C(=O)O)c1nncc(C2CCC2)n1 |
| InChI | InChI=1S/C10H13N3O2/c1-6(10(14)15)9-12-8(5-11-13-9)7-3-2-4-7/h5-7H,2-4H2,1H3,(H,14,15) |
| InChIKey | RKMCFDFPEINNEP-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 75.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(5-cyclobutyl-1,2,4-triazin-3-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-cyclobutyl-1,2,4-triazin-3-yl)propanoic acid?
The IUPAC name of 2-(5-cyclobutyl-1,2,4-triazin-3-yl)propanoic acid (CID 105460244) is 2-(5-cyclobutyl-1,2,4-triazin-3-yl)propanoic acid.
What is the SMILES notation for 2-(5-cyclobutyl-1,2,4-triazin-3-yl)propanoic acid?
The canonical SMILES for 2-(5-cyclobutyl-1,2,4-triazin-3-yl)propanoic acid is CC(C(=O)O)c1nncc(C2CCC2)n1.
What is the InChIKey of 2-(5-cyclobutyl-1,2,4-triazin-3-yl)propanoic acid?
The InChIKey is RKMCFDFPEINNEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3O2/c1-6(10(14)15)9-12-8(5-11-13-9)7-3-2-4-7/h5-7H,2-4H2,1H3,(H,14,15).
What are the key properties of 2-(5-cyclobutyl-1,2,4-triazin-3-yl)propanoic acid?
2-(5-cyclobutyl-1,2,4-triazin-3-yl)propanoic acid has a molecular weight of 207.23 g/mol, XLogP of 1.33, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-cyclobutyl-1,2,4-triazin-3-yl)propanoic acid is sourced from PubChem (CID 105460244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).