C12H17NO2 — CID 105460570
2-[[1-(aminomethyl)cyclobutyl]-hydroxymethyl]phenol (PubChem CID 105460570) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is 2-[[1-(aminomethyl)cyclobutyl]-hydroxymethyl]phenol.
| Compound Name | 2-[[1-(aminomethyl)cyclobutyl]-hydroxymethyl]phenol |
|---|---|
| PubChem CID | 105460570 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 2-[[1-(aminomethyl)cyclobutyl]-hydroxymethyl]phenol |
| SMILES | NCC1(C(O)c2ccccc2O)CCC1 |
| InChI | InChI=1S/C12H17NO2/c13-8-12(6-3-7-12)11(15)9-4-1-2-5-10(9)14/h1-2,4-5,11,14-15H,3,6-8,13H2 |
| InChIKey | GGFMESPZBSPFSD-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |