C12H17NO2 — CID 105460600
2-methoxy-6-(oxolan-2-ylmethyl)aniline (PubChem CID 105460600) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is 2-methoxy-6-(oxolan-2-ylmethyl)aniline.
| Compound Name | 2-methoxy-6-(oxolan-2-ylmethyl)aniline |
|---|---|
| PubChem CID | 105460600 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 2-methoxy-6-(oxolan-2-ylmethyl)aniline |
| SMILES | COc1cccc(CC2CCCO2)c1N |
| InChI | InChI=1S/C12H17NO2/c1-14-11-6-2-4-9(12(11)13)8-10-5-3-7-15-10/h2,4,6,10H,3,5,7-8,13H2,1H3 |
| InChIKey | CINKJCCCFUXQCG-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|