C12H17NO2 — CID 105460610
N-[2-(4-hydroxybutyl)phenyl]acetamide (PubChem CID 105460610) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is N-[2-(4-hydroxybutyl)phenyl]acetamide.
| Compound Name | N-[2-(4-hydroxybutyl)phenyl]acetamide |
|---|---|
| PubChem CID | 105460610 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | N-[2-(4-hydroxybutyl)phenyl]acetamide |
| SMILES | CC(=O)Nc1ccccc1CCCCO |
| InChI | InChI=1S/C12H17NO2/c1-10(15)13-12-8-3-2-6-11(12)7-4-5-9-14/h2-3,6,8,14H,4-5,7,9H2,1H3,(H,13,15) |
| InChIKey | WSVUBPFBRZUTGN-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|