C11H17N3O — CID 105460739
1-(oxan-3-yl)-4,5,6,7-tetrahydropyrazolo[4,5-c]pyridine (PubChem CID 105460739) has the molecular formula C11H17N3O and a molecular weight of 207.28 g/mol. Its IUPAC name is 1-(oxan-3-yl)-4,5,6,7-tetrahydropyrazolo[4,5-c]pyridine.
| Compound Name | 1-(oxan-3-yl)-4,5,6,7-tetrahydropyrazolo[4,5-c]pyridine |
|---|---|
| PubChem CID | 105460739 |
| Molecular Formula | C11H17N3O |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | 1-(oxan-3-yl)-4,5,6,7-tetrahydropyrazolo[4,5-c]pyridine |
| SMILES | c1nn(C2CCCOC2)c2c1CNCC2 |
| InChI | InChI=1S/C11H17N3O/c1-2-10(8-15-5-1)14-11-3-4-12-6-9(11)7-13-14/h7,10,12H,1-6,8H2 |
| InChIKey | JRGGCAOEBOUZBI-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |