C8H17NO3S — CID 105460996
4-(2-aminopropan-2-yl)-1,1-dioxothian-4-ol (PubChem CID 105460996) has the molecular formula C8H17NO3S and a molecular weight of 207.29 g/mol. Its IUPAC name is 4-(2-aminopropan-2-yl)-1,1-dioxothian-4-ol.
| Compound Name | 4-(2-aminopropan-2-yl)-1,1-dioxothian-4-ol |
|---|---|
| PubChem CID | 105460996 |
| Molecular Formula | C8H17NO3S |
| Molecular Weight | 207.29 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | 4-(2-aminopropan-2-yl)-1,1-dioxothian-4-ol |
| SMILES | CC(C)(N)C1(O)CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C8H17NO3S/c1-7(2,9)8(10)3-5-13(11,12)6-4-8/h10H,3-6,9H2,1-2H3 |
| InChIKey | AAOZVUDZSRGVTD-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.29 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |