About 8-fluoro-4-propyl-3,4-dihydro-1H-quinazolin-2-one
8-fluoro-4-propyl-3,4-dihydro-1H-quinazolin-2-one (PubChem CID 105461666) has the molecular formula C11H13FN2O
and a molecular weight of 208.24 g/mol. Its IUPAC name is 8-fluoro-4-propyl-3,4-dihydro-1H-quinazolin-2-one.
Molecular Properties
| Compound Name | 8-fluoro-4-propyl-3,4-dihydro-1H-quinazolin-2-one |
| PubChem CID | 105461666 |
| Molecular Formula | C11H13FN2O |
| Molecular Weight | 208.24 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 8-fluoro-4-propyl-3,4-dihydro-1H-quinazolin-2-one |
| SMILES | CCCC1NC(=O)Nc2c(F)cccc21 |
| InChI | InChI=1S/C11H13FN2O/c1-2-4-9-7-5-3-6-8(12)10(7)14-11(15)13-9/h3,5-6,9H,2,4H2,1H3,(H2,13,14,15) |
| InChIKey | GINZQJIIUVJXEM-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.24 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 8-fluoro-4-propyl-3,4-dihydro-1H-quinazolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-fluoro-4-propyl-3,4-dihydro-1H-quinazolin-2-one?
The IUPAC name of 8-fluoro-4-propyl-3,4-dihydro-1H-quinazolin-2-one (CID 105461666) is 8-fluoro-4-propyl-3,4-dihydro-1H-quinazolin-2-one.
What is the SMILES notation for 8-fluoro-4-propyl-3,4-dihydro-1H-quinazolin-2-one?
The canonical SMILES for 8-fluoro-4-propyl-3,4-dihydro-1H-quinazolin-2-one is CCCC1NC(=O)Nc2c(F)cccc21.
What is the InChIKey of 8-fluoro-4-propyl-3,4-dihydro-1H-quinazolin-2-one?
The InChIKey is GINZQJIIUVJXEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13FN2O/c1-2-4-9-7-5-3-6-8(12)10(7)14-11(15)13-9/h3,5-6,9H,2,4H2,1H3,(H2,13,14,15).
What are the key properties of 8-fluoro-4-propyl-3,4-dihydro-1H-quinazolin-2-one?
8-fluoro-4-propyl-3,4-dihydro-1H-quinazolin-2-one has a molecular weight of 208.24 g/mol, XLogP of 2.80, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-fluoro-4-propyl-3,4-dihydro-1H-quinazolin-2-one is sourced from PubChem (CID 105461666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).