About 1-cyclohexyl-4,6-dihydro-2H-furo[3,4-c]pyrazol-3-one
1-cyclohexyl-4,6-dihydro-2H-furo[3,4-c]pyrazol-3-one (PubChem CID 105461795) has the molecular formula C11H16N2O2
and a molecular weight of 208.26 g/mol. Its IUPAC name is 1-cyclohexyl-4,6-dihydro-2H-furo[3,4-c]pyrazol-3-one.
Molecular Properties
| Compound Name | 1-cyclohexyl-4,6-dihydro-2H-furo[3,4-c]pyrazol-3-one |
| PubChem CID | 105461795 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 1-cyclohexyl-4,6-dihydro-2H-furo[3,4-c]pyrazol-3-one |
| SMILES | O=c1[nH]n(C2CCCCC2)c2c1COC2 |
| InChI | InChI=1S/C11H16N2O2/c14-11-9-6-15-7-10(9)13(12-11)8-4-2-1-3-5-8/h8H,1-7H2,(H,12,14) |
| InChIKey | LXKPATKDTWFSGQ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-cyclohexyl-4,6-dihydro-2H-furo[3,4-c]pyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-4,6-dihydro-2H-furo[3,4-c]pyrazol-3-one?
The IUPAC name of 1-cyclohexyl-4,6-dihydro-2H-furo[3,4-c]pyrazol-3-one (CID 105461795) is 1-cyclohexyl-4,6-dihydro-2H-furo[3,4-c]pyrazol-3-one.
What is the SMILES notation for 1-cyclohexyl-4,6-dihydro-2H-furo[3,4-c]pyrazol-3-one?
The canonical SMILES for 1-cyclohexyl-4,6-dihydro-2H-furo[3,4-c]pyrazol-3-one is O=c1[nH]n(C2CCCCC2)c2c1COC2.
What is the InChIKey of 1-cyclohexyl-4,6-dihydro-2H-furo[3,4-c]pyrazol-3-one?
The InChIKey is LXKPATKDTWFSGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O2/c14-11-9-6-15-7-10(9)13(12-11)8-4-2-1-3-5-8/h8H,1-7H2,(H,12,14).
What are the key properties of 1-cyclohexyl-4,6-dihydro-2H-furo[3,4-c]pyrazol-3-one?
1-cyclohexyl-4,6-dihydro-2H-furo[3,4-c]pyrazol-3-one has a molecular weight of 208.26 g/mol, XLogP of 1.71, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-4,6-dihydro-2H-furo[3,4-c]pyrazol-3-one is sourced from PubChem (CID 105461795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).