C23H32O3 — CID 10546199
(8aR)-8,8-dimethyl-5-pentyl-2,3,4,8a,9,10,12,12a-octahydroisochromeno[3,4-h]chromen-11-one (PubChem CID 10546199) has the molecular formula C23H32O3 and a molecular weight of 356.51 g/mol. Its IUPAC name is (8aR)-8,8-dimethyl-5-pentyl-2,3,4,8a,9,10,12,12a-octahydroisochromeno[3,4-h]chromen-11-one.
| Compound Name | (8aR)-8,8-dimethyl-5-pentyl-2,3,4,8a,9,10,12,12a-octahydroisochromeno[3,4-h]chromen-11-one |
|---|---|
| PubChem CID | 10546199 |
| Molecular Formula | C23H32O3 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | (8aR)-8,8-dimethyl-5-pentyl-2,3,4,8a,9,10,12,12a-octahydroisochromeno[3,4-h]chromen-11-one |
| SMILES | CCCCCc1cc2c(c3c1CCCO3)C1CC(=O)CC[C@H]1C(C)(C)O2 |
| InChI | InChI=1S/C23H32O3/c1-4-5-6-8-15-13-20-21(22-17(15)9-7-12-25-22)18-14-16(24)10-11-19(18)23(2,3)26-20/h13,18-19H,4-12,14H2,1-3H3/t18?,19-/m1/s1 |
| InChIKey | NNVGQPKFTFCOLW-MUMRKEEXSA-N |
| XLogP | 5.37 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|