About 7-O-tert-butyl 1-O-ethyl (E,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]hept-2-enedioate
7-O-tert-butyl 1-O-ethyl (E,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]hept-2-enedioate (PubChem CID 10546262) has the molecular formula C18H31NO6
and a molecular weight of 357.45 g/mol. Its IUPAC name is 7-O-tert-butyl 1-O-ethyl (E,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]hept-2-enedioate.
Molecular Properties
| Compound Name | 7-O-tert-butyl 1-O-ethyl (E,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]hept-2-enedioate |
| PubChem CID | 10546262 |
| Molecular Formula | C18H31NO6 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.22 |
| IUPAC Name | 7-O-tert-butyl 1-O-ethyl (E,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]hept-2-enedioate |
| SMILES | CCOC(=O)/C=C/[C@H](CCC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H31NO6/c1-8-23-14(20)11-9-13(19-16(22)25-18(5,6)7)10-12-15(21)24-17(2,3)4/h9,11,13H,8,10,12H2,1-7H3,(H,19,22)/b11-9+/t13-/m1/s1 |
| InChIKey | DZGWOHUQPGAKGE-YGNAEDSMSA-N |
| XLogP | 3.12 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 7-O-tert-butyl 1-O-ethyl (E,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]hept-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-O-tert-butyl 1-O-ethyl (E,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]hept-2-enedioate?
The IUPAC name of 7-O-tert-butyl 1-O-ethyl (E,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]hept-2-enedioate (CID 10546262) is 7-O-tert-butyl 1-O-ethyl (E,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]hept-2-enedioate.
What is the SMILES notation for 7-O-tert-butyl 1-O-ethyl (E,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]hept-2-enedioate?
The canonical SMILES for 7-O-tert-butyl 1-O-ethyl (E,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]hept-2-enedioate is CCOC(=O)/C=C/[C@H](CCC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C.
What is the InChIKey of 7-O-tert-butyl 1-O-ethyl (E,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]hept-2-enedioate?
The InChIKey is DZGWOHUQPGAKGE-YGNAEDSMSA-N. The full InChI is InChI=1S/C18H31NO6/c1-8-23-14(20)11-9-13(19-16(22)25-18(5,6)7)10-12-15(21)24-17(2,3)4/h9,11,13H,8,10,12H2,1-7H3,(H,19,22)/b11-9+/t13-/m1/s1.
What are the key properties of 7-O-tert-butyl 1-O-ethyl (E,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]hept-2-enedioate?
7-O-tert-butyl 1-O-ethyl (E,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]hept-2-enedioate has a molecular weight of 357.45 g/mol, XLogP of 3.12, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-O-tert-butyl 1-O-ethyl (E,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]hept-2-enedioate is sourced from PubChem (CID 10546262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).