About 2-(4-fluoro-1,1-dioxothian-4-yl)propan-1-amine
2-(4-fluoro-1,1-dioxothian-4-yl)propan-1-amine (PubChem CID 105463187) has the molecular formula C8H16FNO2S
and a molecular weight of 209.29 g/mol. Its IUPAC name is 2-(4-fluoro-1,1-dioxothian-4-yl)propan-1-amine.
Molecular Properties
| Compound Name | 2-(4-fluoro-1,1-dioxothian-4-yl)propan-1-amine |
| PubChem CID | 105463187 |
| Molecular Formula | C8H16FNO2S |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | 2-(4-fluoro-1,1-dioxothian-4-yl)propan-1-amine |
| SMILES | CC(CN)C1(F)CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C8H16FNO2S/c1-7(6-10)8(9)2-4-13(11,12)5-3-8/h7H,2-6,10H2,1H3 |
| InChIKey | WZPOOOOVQZSMLG-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-fluoro-1,1-dioxothian-4-yl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-fluoro-1,1-dioxothian-4-yl)propan-1-amine?
The IUPAC name of 2-(4-fluoro-1,1-dioxothian-4-yl)propan-1-amine (CID 105463187) is 2-(4-fluoro-1,1-dioxothian-4-yl)propan-1-amine.
What is the SMILES notation for 2-(4-fluoro-1,1-dioxothian-4-yl)propan-1-amine?
The canonical SMILES for 2-(4-fluoro-1,1-dioxothian-4-yl)propan-1-amine is CC(CN)C1(F)CCS(=O)(=O)CC1.
What is the InChIKey of 2-(4-fluoro-1,1-dioxothian-4-yl)propan-1-amine?
The InChIKey is WZPOOOOVQZSMLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16FNO2S/c1-7(6-10)8(9)2-4-13(11,12)5-3-8/h7H,2-6,10H2,1H3.
What are the key properties of 2-(4-fluoro-1,1-dioxothian-4-yl)propan-1-amine?
2-(4-fluoro-1,1-dioxothian-4-yl)propan-1-amine has a molecular weight of 209.29 g/mol, XLogP of 0.50, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-fluoro-1,1-dioxothian-4-yl)propan-1-amine is sourced from PubChem (CID 105463187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).