C8H16FNO2S — CID 105463188
2-(3-fluoro-1,1-dioxothian-3-yl)propan-1-amine (PubChem CID 105463188) has the molecular formula C8H16FNO2S and a molecular weight of 209.29 g/mol. Its IUPAC name is 2-(3-fluoro-1,1-dioxothian-3-yl)propan-1-amine.
| Compound Name | 2-(3-fluoro-1,1-dioxothian-3-yl)propan-1-amine |
|---|---|
| PubChem CID | 105463188 |
| Molecular Formula | C8H16FNO2S |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | 2-(3-fluoro-1,1-dioxothian-3-yl)propan-1-amine |
| SMILES | CC(CN)C1(F)CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C8H16FNO2S/c1-7(5-10)8(9)3-2-4-13(11,12)6-8/h7H,2-6,10H2,1H3 |
| InChIKey | BFRVSONBPASUJH-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |