C10H11FN2O2 — CID 105463801
3-[(3-amino-4-fluorophenyl)methyl]-1,3-oxazolidin-2-one (PubChem CID 105463801) has the molecular formula C10H11FN2O2 and a molecular weight of 210.21 g/mol. Its IUPAC name is 3-[(3-amino-4-fluorophenyl)methyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[(3-amino-4-fluorophenyl)methyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 105463801 |
| Molecular Formula | C10H11FN2O2 |
| Molecular Weight | 210.21 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 3-[(3-amino-4-fluorophenyl)methyl]-1,3-oxazolidin-2-one |
| SMILES | Nc1cc(CN2CCOC2=O)ccc1F |
| InChI | InChI=1S/C10H11FN2O2/c11-8-2-1-7(5-9(8)12)6-13-3-4-15-10(13)14/h1-2,5H,3-4,6,12H2 |
| InChIKey | YZRKKRARQHPTDQ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.21 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|