C22H25N5 — CID 10546397
6-N-benzyl-4-N-cyclopentyl-2-phenylpyrimidine-4,5,6-triamine (PubChem CID 10546397) has the molecular formula C22H25N5 and a molecular weight of 359.48 g/mol. Its IUPAC name is 6-N-benzyl-4-N-cyclopentyl-2-phenylpyrimidine-4,5,6-triamine.
| Compound Name | 6-N-benzyl-4-N-cyclopentyl-2-phenylpyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 10546397 |
| Molecular Formula | C22H25N5 |
| Molecular Weight | 359.48 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | 6-N-benzyl-4-N-cyclopentyl-2-phenylpyrimidine-4,5,6-triamine |
| SMILES | Nc1c(NCc2ccccc2)nc(-c2ccccc2)nc1NC1CCCC1 |
| InChI | InChI=1S/C22H25N5/c23-19-21(24-15-16-9-3-1-4-10-16)26-20(17-11-5-2-6-12-17)27-22(19)25-18-13-7-8-14-18/h1-6,9-12,18H,7-8,13-15,23H2,(H2,24,25,26,27) |
| InChIKey | STNVUDFLUKUEOX-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.48 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |