C22H30ClNO — CID 10546411
(2S,3S)-1,1-dibenzyl-3-methyl-2-(2-methylpropyl)azetidin-1-ium-3-ol chloride (PubChem CID 10546411) has the molecular formula C22H30ClNO and a molecular weight of 359.94 g/mol. Its IUPAC name is (2S,3S)-1,1-dibenzyl-3-methyl-2-(2-methylpropyl)azetidin-1-ium-3-ol chloride.
| Compound Name | (2S,3S)-1,1-dibenzyl-3-methyl-2-(2-methylpropyl)azetidin-1-ium-3-ol chloride |
|---|---|
| PubChem CID | 10546411 |
| Molecular Formula | C22H30ClNO |
| Molecular Weight | 359.94 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | (2S,3S)-1,1-dibenzyl-3-methyl-2-(2-methylpropyl)azetidin-1-ium-3-ol chloride |
| SMILES | CC(C)C[C@H]1[C@@](C)(O)C[N+]1(Cc1ccccc1)Cc1ccccc1.[Cl-] |
| InChI | InChI=1S/C22H30NO.ClH/c1-18(2)14-21-22(3,24)17-23(21,15-19-10-6-4-7-11-19)16-20-12-8-5-9-13-20;/h4-13,18,21,24H,14-17H2,1-3H3;1H/q+1;/p-1/t21-,22-;/m0./s1 |
| InChIKey | IBSQZHSBCUUODV-VROPFNGYSA-M |
| XLogP | 1.39 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.94 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|