C10H11ClN2O — CID 105464586
1-(2-chloro-5,6,7,8-tetrahydro-1,6-naphthyridin-3-yl)ethanone (PubChem CID 105464586) has the molecular formula C10H11ClN2O and a molecular weight of 210.66 g/mol. Its IUPAC name is 1-(2-chloro-5,6,7,8-tetrahydro-1,6-naphthyridin-3-yl)ethanone.
| Compound Name | 1-(2-chloro-5,6,7,8-tetrahydro-1,6-naphthyridin-3-yl)ethanone |
|---|---|
| PubChem CID | 105464586 |
| Molecular Formula | C10H11ClN2O |
| Molecular Weight | 210.66 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | 1-(2-chloro-5,6,7,8-tetrahydro-1,6-naphthyridin-3-yl)ethanone |
| SMILES | CC(=O)c1cc2c(nc1Cl)CCNC2 |
| InChI | InChI=1S/C10H11ClN2O/c1-6(14)8-4-7-5-12-3-2-9(7)13-10(8)11/h4,12H,2-3,5H2,1H3 |
| InChIKey | AYVDSPAHSXHPTL-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.66 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|