C7H11F2NO2S — CID 105464841
2-(1,1-dioxo-3,6-dihydro-2H-thiopyran-4-yl)-2,2-difluoroethanamine (PubChem CID 105464841) has the molecular formula C7H11F2NO2S and a molecular weight of 211.23 g/mol. Its IUPAC name is 2-(1,1-dioxo-3,6-dihydro-2H-thiopyran-4-yl)-2,2-difluoroethanamine.
| Compound Name | 2-(1,1-dioxo-3,6-dihydro-2H-thiopyran-4-yl)-2,2-difluoroethanamine |
|---|---|
| PubChem CID | 105464841 |
| Molecular Formula | C7H11F2NO2S |
| Molecular Weight | 211.23 g/mol |
| Exact Mass | 211.05 |
| IUPAC Name | 2-(1,1-dioxo-3,6-dihydro-2H-thiopyran-4-yl)-2,2-difluoroethanamine |
| SMILES | NCC(F)(F)C1=CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C7H11F2NO2S/c8-7(9,5-10)6-1-3-13(11,12)4-2-6/h1H,2-5,10H2 |
| InChIKey | QKSXZZHLJYOGKK-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.23 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|