C20H27NO5 — CID 10546526
(E)-N-[[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-3-phenylprop-2-en-1-imine oxide (PubChem CID 10546526) has the molecular formula C20H27NO5 and a molecular weight of 361.44 g/mol. Its IUPAC name is (E)-N-[[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-3-phenylprop-2-en-1-imine oxide.
| Compound Name | (E)-N-[[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-3-phenylprop-2-en-1-imine oxide |
|---|---|
| PubChem CID | 10546526 |
| Molecular Formula | C20H27NO5 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | (E)-N-[[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-3-phenylprop-2-en-1-imine oxide |
| SMILES | CC1(C)OC[C@H]([C@H]2OC(C)(C)O[C@@H]2C/[N+]([O-])=C/C=C/c2ccccc2)O1 |
| InChI | InChI=1S/C20H27NO5/c1-19(2)23-14-17(25-19)18-16(24-20(3,4)26-18)13-21(22)12-8-11-15-9-6-5-7-10-15/h5-12,16-18H,13-14H2,1-4H3/b11-8+,21-12-/t16-,17-,18+/m1/s1 |
| InChIKey | GSSWGSXULUISOP-NPCAPLQFSA-N |
| XLogP | 2.95 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|