2-(1-methyl-3-oxo-1,2-diazaspiro[4.4]nonan-2-yl)acetic acid

C10H16N2O3 — CID 105465896

IUPAC2-(1-methyl-3-oxo-1,2-diazaspiro[4.4]nonan-2-yl)acetic acid
SMILESCN1N(CC(=O)O)C(=O)CC12CCCC2
InChIInChI=1S/C10H16N2O3/c1-11-10(4-2-3-5-10)6-8(13)12(11)7-9(14)15/h2-7H2,1H3,(H,14,15)
InChIKeyFKQCETVOWGZUCD-UHFFFAOYSA-N
MW212.25 g/mol
LogP0.46
Rot. Bonds2

About 2-(1-methyl-3-oxo-1,2-diazaspiro[4.4]nonan-2-yl)acetic acid

2-(1-methyl-3-oxo-1,2-diazaspiro[4.4]nonan-2-yl)acetic acid (PubChem CID 105465896) has the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. Its IUPAC name is 2-(1-methyl-3-oxo-1,2-diazaspiro[4.4]nonan-2-yl)acetic acid.

Molecular Properties

Compound Name2-(1-methyl-3-oxo-1,2-diazaspiro[4.4]nonan-2-yl)acetic acid
PubChem CID105465896
Molecular FormulaC10H16N2O3
Molecular Weight212.25 g/mol
Exact Mass212.12
IUPAC Name2-(1-methyl-3-oxo-1,2-diazaspiro[4.4]nonan-2-yl)acetic acid
SMILESCN1N(CC(=O)O)C(=O)CC12CCCC2
InChIInChI=1S/C10H16N2O3/c1-11-10(4-2-3-5-10)6-8(13)12(11)7-9(14)15/h2-7H2,1H3,(H,14,15)
InChIKeyFKQCETVOWGZUCD-UHFFFAOYSA-N
XLogP0.46
TPSA60.85 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500212.25
LogP ≤ 50.46
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(1-methyl-3-oxo-1,2-diazaspiro[4.4]nonan-2-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1-methyl-3-oxo-1,2-diazaspiro[4.4]nonan-2-yl)acetic acid?
The IUPAC name of 2-(1-methyl-3-oxo-1,2-diazaspiro[4.4]nonan-2-yl)acetic acid (CID 105465896) is 2-(1-methyl-3-oxo-1,2-diazaspiro[4.4]nonan-2-yl)acetic acid.
What is the SMILES notation for 2-(1-methyl-3-oxo-1,2-diazaspiro[4.4]nonan-2-yl)acetic acid?
The canonical SMILES for 2-(1-methyl-3-oxo-1,2-diazaspiro[4.4]nonan-2-yl)acetic acid is CN1N(CC(=O)O)C(=O)CC12CCCC2.
What is the InChIKey of 2-(1-methyl-3-oxo-1,2-diazaspiro[4.4]nonan-2-yl)acetic acid?
The InChIKey is FKQCETVOWGZUCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O3/c1-11-10(4-2-3-5-10)6-8(13)12(11)7-9(14)15/h2-7H2,1H3,(H,14,15).
What are the key properties of 2-(1-methyl-3-oxo-1,2-diazaspiro[4.4]nonan-2-yl)acetic acid?
2-(1-methyl-3-oxo-1,2-diazaspiro[4.4]nonan-2-yl)acetic acid has a molecular weight of 212.25 g/mol, XLogP of 0.46, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-methyl-3-oxo-1,2-diazaspiro[4.4]nonan-2-yl)acetic acid is sourced from PubChem (CID 105465896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).