About 2-(4-methoxy-5,7-dihydrothieno[3,4-d]pyrimidin-2-yl)ethanol
2-(4-methoxy-5,7-dihydrothieno[3,4-d]pyrimidin-2-yl)ethanol (PubChem CID 105466025) has the molecular formula C9H12N2O2S
and a molecular weight of 212.27 g/mol. Its IUPAC name is 2-(4-methoxy-5,7-dihydrothieno[3,4-d]pyrimidin-2-yl)ethanol.
Molecular Properties
| Compound Name | 2-(4-methoxy-5,7-dihydrothieno[3,4-d]pyrimidin-2-yl)ethanol |
| PubChem CID | 105466025 |
| Molecular Formula | C9H12N2O2S |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | 2-(4-methoxy-5,7-dihydrothieno[3,4-d]pyrimidin-2-yl)ethanol |
| SMILES | COc1nc(CCO)nc2c1CSC2 |
| InChI | InChI=1S/C9H12N2O2S/c1-13-9-6-4-14-5-7(6)10-8(11-9)2-3-12/h12H,2-5H2,1H3 |
| InChIKey | QJSQKSGSYFSSAB-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(4-methoxy-5,7-dihydrothieno[3,4-d]pyrimidin-2-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methoxy-5,7-dihydrothieno[3,4-d]pyrimidin-2-yl)ethanol?
The IUPAC name of 2-(4-methoxy-5,7-dihydrothieno[3,4-d]pyrimidin-2-yl)ethanol (CID 105466025) is 2-(4-methoxy-5,7-dihydrothieno[3,4-d]pyrimidin-2-yl)ethanol.
What is the SMILES notation for 2-(4-methoxy-5,7-dihydrothieno[3,4-d]pyrimidin-2-yl)ethanol?
The canonical SMILES for 2-(4-methoxy-5,7-dihydrothieno[3,4-d]pyrimidin-2-yl)ethanol is COc1nc(CCO)nc2c1CSC2.
What is the InChIKey of 2-(4-methoxy-5,7-dihydrothieno[3,4-d]pyrimidin-2-yl)ethanol?
The InChIKey is QJSQKSGSYFSSAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O2S/c1-13-9-6-4-14-5-7(6)10-8(11-9)2-3-12/h12H,2-5H2,1H3.
What are the key properties of 2-(4-methoxy-5,7-dihydrothieno[3,4-d]pyrimidin-2-yl)ethanol?
2-(4-methoxy-5,7-dihydrothieno[3,4-d]pyrimidin-2-yl)ethanol has a molecular weight of 212.27 g/mol, XLogP of 0.77, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methoxy-5,7-dihydrothieno[3,4-d]pyrimidin-2-yl)ethanol is sourced from PubChem (CID 105466025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).