About 4-ethyl-5-methyl-2-thiomorpholin-3-yl-1,3-oxazole
4-ethyl-5-methyl-2-thiomorpholin-3-yl-1,3-oxazole (PubChem CID 105466255) has the molecular formula C10H16N2OS
and a molecular weight of 212.32 g/mol. Its IUPAC name is 4-ethyl-5-methyl-2-thiomorpholin-3-yl-1,3-oxazole.
Molecular Properties
| Compound Name | 4-ethyl-5-methyl-2-thiomorpholin-3-yl-1,3-oxazole |
| PubChem CID | 105466255 |
| Molecular Formula | C10H16N2OS |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 4-ethyl-5-methyl-2-thiomorpholin-3-yl-1,3-oxazole |
| SMILES | CCc1nc(C2CSCCN2)oc1C |
| InChI | InChI=1S/C10H16N2OS/c1-3-8-7(2)13-10(12-8)9-6-14-5-4-11-9/h9,11H,3-6H2,1-2H3 |
| InChIKey | PFKKQDJJVRJXLD-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-ethyl-5-methyl-2-thiomorpholin-3-yl-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-5-methyl-2-thiomorpholin-3-yl-1,3-oxazole?
The IUPAC name of 4-ethyl-5-methyl-2-thiomorpholin-3-yl-1,3-oxazole (CID 105466255) is 4-ethyl-5-methyl-2-thiomorpholin-3-yl-1,3-oxazole.
What is the SMILES notation for 4-ethyl-5-methyl-2-thiomorpholin-3-yl-1,3-oxazole?
The canonical SMILES for 4-ethyl-5-methyl-2-thiomorpholin-3-yl-1,3-oxazole is CCc1nc(C2CSCCN2)oc1C.
What is the InChIKey of 4-ethyl-5-methyl-2-thiomorpholin-3-yl-1,3-oxazole?
The InChIKey is PFKKQDJJVRJXLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2OS/c1-3-8-7(2)13-10(12-8)9-6-14-5-4-11-9/h9,11H,3-6H2,1-2H3.
What are the key properties of 4-ethyl-5-methyl-2-thiomorpholin-3-yl-1,3-oxazole?
4-ethyl-5-methyl-2-thiomorpholin-3-yl-1,3-oxazole has a molecular weight of 212.32 g/mol, XLogP of 1.92, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-5-methyl-2-thiomorpholin-3-yl-1,3-oxazole is sourced from PubChem (CID 105466255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).