About 4-[2-(1-aminocyclopropyl)ethyl]-3,5-difluorophenol
4-[2-(1-aminocyclopropyl)ethyl]-3,5-difluorophenol (PubChem CID 105466615) has the molecular formula C11H13F2NO
and a molecular weight of 213.23 g/mol. Its IUPAC name is 4-[2-(1-aminocyclopropyl)ethyl]-3,5-difluorophenol.
Molecular Properties
| Compound Name | 4-[2-(1-aminocyclopropyl)ethyl]-3,5-difluorophenol |
| PubChem CID | 105466615 |
| Molecular Formula | C11H13F2NO |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 4-[2-(1-aminocyclopropyl)ethyl]-3,5-difluorophenol |
| SMILES | NC1(CCc2c(F)cc(O)cc2F)CC1 |
| InChI | InChI=1S/C11H13F2NO/c12-9-5-7(15)6-10(13)8(9)1-2-11(14)3-4-11/h5-6,15H,1-4,14H2 |
| InChIKey | KFHJHTYTANYPAB-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[2-(1-aminocyclopropyl)ethyl]-3,5-difluorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(1-aminocyclopropyl)ethyl]-3,5-difluorophenol?
The IUPAC name of 4-[2-(1-aminocyclopropyl)ethyl]-3,5-difluorophenol (CID 105466615) is 4-[2-(1-aminocyclopropyl)ethyl]-3,5-difluorophenol.
What is the SMILES notation for 4-[2-(1-aminocyclopropyl)ethyl]-3,5-difluorophenol?
The canonical SMILES for 4-[2-(1-aminocyclopropyl)ethyl]-3,5-difluorophenol is NC1(CCc2c(F)cc(O)cc2F)CC1.
What is the InChIKey of 4-[2-(1-aminocyclopropyl)ethyl]-3,5-difluorophenol?
The InChIKey is KFHJHTYTANYPAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13F2NO/c12-9-5-7(15)6-10(13)8(9)1-2-11(14)3-4-11/h5-6,15H,1-4,14H2.
What are the key properties of 4-[2-(1-aminocyclopropyl)ethyl]-3,5-difluorophenol?
4-[2-(1-aminocyclopropyl)ethyl]-3,5-difluorophenol has a molecular weight of 213.23 g/mol, XLogP of 2.09, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(1-aminocyclopropyl)ethyl]-3,5-difluorophenol is sourced from PubChem (CID 105466615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).