C7H13F2NO2S — CID 105466693
(3,3-difluoro-4-methyl-1,1-dioxothian-4-yl)methanamine (PubChem CID 105466693) has the molecular formula C7H13F2NO2S and a molecular weight of 213.25 g/mol. Its IUPAC name is (3,3-difluoro-4-methyl-1,1-dioxothian-4-yl)methanamine.
| Compound Name | (3,3-difluoro-4-methyl-1,1-dioxothian-4-yl)methanamine |
|---|---|
| PubChem CID | 105466693 |
| Molecular Formula | C7H13F2NO2S |
| Molecular Weight | 213.25 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | (3,3-difluoro-4-methyl-1,1-dioxothian-4-yl)methanamine |
| SMILES | CC1(CN)CCS(=O)(=O)CC1(F)F |
| InChI | InChI=1S/C7H13F2NO2S/c1-6(4-10)2-3-13(11,12)5-7(6,8)9/h2-5,10H2,1H3 |
| InChIKey | DONRAYIAFJGRPG-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.25 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |