2-[5-(thiolan-2-yl)-1,2-oxazol-4-yl]acetic acid

C9H11NO3S — CID 105466706

IUPAC2-[5-(thiolan-2-yl)-1,2-oxazol-4-yl]acetic acid
SMILESO=C(O)Cc1cnoc1C1CCCS1
InChIInChI=1S/C9H11NO3S/c11-8(12)4-6-5-10-13-9(6)7-2-1-3-14-7/h5,7H,1-4H2,(H,11,12)
InChIKeyANSHPCJTLCKBAB-UHFFFAOYSA-N
MW213.26 g/mol
LogP1.87
Rot. Bonds3

About 2-[5-(thiolan-2-yl)-1,2-oxazol-4-yl]acetic acid

2-[5-(thiolan-2-yl)-1,2-oxazol-4-yl]acetic acid (PubChem CID 105466706) has the molecular formula C9H11NO3S and a molecular weight of 213.26 g/mol. Its IUPAC name is 2-[5-(thiolan-2-yl)-1,2-oxazol-4-yl]acetic acid.

Molecular Properties

Compound Name2-[5-(thiolan-2-yl)-1,2-oxazol-4-yl]acetic acid
PubChem CID105466706
Molecular FormulaC9H11NO3S
Molecular Weight213.26 g/mol
Exact Mass213.05
IUPAC Name2-[5-(thiolan-2-yl)-1,2-oxazol-4-yl]acetic acid
SMILESO=C(O)Cc1cnoc1C1CCCS1
InChIInChI=1S/C9H11NO3S/c11-8(12)4-6-5-10-13-9(6)7-2-1-3-14-7/h5,7H,1-4H2,(H,11,12)
InChIKeyANSHPCJTLCKBAB-UHFFFAOYSA-N
XLogP1.87
TPSA63.33 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500213.26
LogP ≤ 51.87
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-[5-(thiolan-2-yl)-1,2-oxazol-4-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[5-(thiolan-2-yl)-1,2-oxazol-4-yl]acetic acid?
The IUPAC name of 2-[5-(thiolan-2-yl)-1,2-oxazol-4-yl]acetic acid (CID 105466706) is 2-[5-(thiolan-2-yl)-1,2-oxazol-4-yl]acetic acid.
What is the SMILES notation for 2-[5-(thiolan-2-yl)-1,2-oxazol-4-yl]acetic acid?
The canonical SMILES for 2-[5-(thiolan-2-yl)-1,2-oxazol-4-yl]acetic acid is O=C(O)Cc1cnoc1C1CCCS1.
What is the InChIKey of 2-[5-(thiolan-2-yl)-1,2-oxazol-4-yl]acetic acid?
The InChIKey is ANSHPCJTLCKBAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO3S/c11-8(12)4-6-5-10-13-9(6)7-2-1-3-14-7/h5,7H,1-4H2,(H,11,12).
What are the key properties of 2-[5-(thiolan-2-yl)-1,2-oxazol-4-yl]acetic acid?
2-[5-(thiolan-2-yl)-1,2-oxazol-4-yl]acetic acid has a molecular weight of 213.26 g/mol, XLogP of 1.87, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(thiolan-2-yl)-1,2-oxazol-4-yl]acetic acid is sourced from PubChem (CID 105466706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).