C10H18N2O3 — CID 105467611
2-(3-hydroxypropyl)-1-oxa-2,8-diazaspiro[4.5]decan-3-one (PubChem CID 105467611) has the molecular formula C10H18N2O3 and a molecular weight of 214.26 g/mol. Its IUPAC name is 2-(3-hydroxypropyl)-1-oxa-2,8-diazaspiro[4.5]decan-3-one.
| Compound Name | 2-(3-hydroxypropyl)-1-oxa-2,8-diazaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 105467611 |
| Molecular Formula | C10H18N2O3 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | 2-(3-hydroxypropyl)-1-oxa-2,8-diazaspiro[4.5]decan-3-one |
| SMILES | O=C1CC2(CCNCC2)ON1CCCO |
| InChI | InChI=1S/C10H18N2O3/c13-7-1-6-12-9(14)8-10(15-12)2-4-11-5-3-10/h11,13H,1-8H2 |
| InChIKey | BCEZJFAVHPXQHR-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |