C10H18N2O3 — CID 105467615
2-(2-aminopropyl)-1,8-dioxa-2-azaspiro[4.5]decan-3-one (PubChem CID 105467615) has the molecular formula C10H18N2O3 and a molecular weight of 214.26 g/mol. Its IUPAC name is 2-(2-aminopropyl)-1,8-dioxa-2-azaspiro[4.5]decan-3-one.
| Compound Name | 2-(2-aminopropyl)-1,8-dioxa-2-azaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 105467615 |
| Molecular Formula | C10H18N2O3 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | 2-(2-aminopropyl)-1,8-dioxa-2-azaspiro[4.5]decan-3-one |
| SMILES | CC(N)CN1OC2(CCOCC2)CC1=O |
| InChI | InChI=1S/C10H18N2O3/c1-8(11)7-12-9(13)6-10(15-12)2-4-14-5-3-10/h8H,2-7,11H2,1H3 |
| InChIKey | KYWGOCQCLOPBPR-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |