C21H16FNO4 — CID 10546781
7-[[2-(4-fluorophenyl)-4-methylidene-5-oxooxolan-2-yl]methoxy]-1H-quinolin-2-one (PubChem CID 10546781) has the molecular formula C21H16FNO4 and a molecular weight of 365.36 g/mol. Its IUPAC name is 7-[[2-(4-fluorophenyl)-4-methylidene-5-oxooxolan-2-yl]methoxy]-1H-quinolin-2-one.
| Compound Name | 7-[[2-(4-fluorophenyl)-4-methylidene-5-oxooxolan-2-yl]methoxy]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 10546781 |
| Molecular Formula | C21H16FNO4 |
| Molecular Weight | 365.36 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | 7-[[2-(4-fluorophenyl)-4-methylidene-5-oxooxolan-2-yl]methoxy]-1H-quinolin-2-one |
| SMILES | C=C1CC(COc2ccc3ccc(=O)[nH]c3c2)(c2ccc(F)cc2)OC1=O |
| InChI | InChI=1S/C21H16FNO4/c1-13-11-21(27-20(13)25,15-4-6-16(22)7-5-15)12-26-17-8-2-14-3-9-19(24)23-18(14)10-17/h2-10H,1,11-12H2,(H,23,24) |
| InChIKey | FGMHUXMQFCPIHC-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.36 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|