C22H24ClN3 — CID 10546828
1-benzyl-4-[3-(4-chlorophenyl)-1H-pyrazol-5-yl]-4-methylpiperidine (PubChem CID 10546828) has the molecular formula C22H24ClN3 and a molecular weight of 365.91 g/mol. Its IUPAC name is 1-benzyl-4-[3-(4-chlorophenyl)-1H-pyrazol-5-yl]-4-methylpiperidine.
| Compound Name | 1-benzyl-4-[3-(4-chlorophenyl)-1H-pyrazol-5-yl]-4-methylpiperidine |
|---|---|
| PubChem CID | 10546828 |
| Molecular Formula | C22H24ClN3 |
| Molecular Weight | 365.91 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 1-benzyl-4-[3-(4-chlorophenyl)-1H-pyrazol-5-yl]-4-methylpiperidine |
| SMILES | CC1(c2cc(-c3ccc(Cl)cc3)n[nH]2)CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C22H24ClN3/c1-22(11-13-26(14-12-22)16-17-5-3-2-4-6-17)21-15-20(24-25-21)18-7-9-19(23)10-8-18/h2-10,15H,11-14,16H2,1H3,(H,24,25) |
| InChIKey | UOIRCOOXVJGCIE-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.91 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |