C20H30O6 — CID 10546872
[5-[(E,3R,4S)-3-acetyloxy-2,4-dimethylhex-1-enyl]-2-ethyl-5-methyl-4-oxofuran-3-yl]methyl acetate (PubChem CID 10546872) has the molecular formula C20H30O6 and a molecular weight of 366.45 g/mol. Its IUPAC name is [5-[(E,3R,4S)-3-acetyloxy-2,4-dimethylhex-1-enyl]-2-ethyl-5-methyl-4-oxofuran-3-yl]methyl acetate.
| Compound Name | [5-[(E,3R,4S)-3-acetyloxy-2,4-dimethylhex-1-enyl]-2-ethyl-5-methyl-4-oxofuran-3-yl]methyl acetate |
|---|---|
| PubChem CID | 10546872 |
| Molecular Formula | C20H30O6 |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | [5-[(E,3R,4S)-3-acetyloxy-2,4-dimethylhex-1-enyl]-2-ethyl-5-methyl-4-oxofuran-3-yl]methyl acetate |
| SMILES | CCC1=C(COC(C)=O)C(=O)C(C)(/C=C(\C)[C@H](OC(C)=O)[C@@H](C)CC)O1 |
| InChI | InChI=1S/C20H30O6/c1-8-12(3)18(25-15(6)22)13(4)10-20(7)19(23)16(11-24-14(5)21)17(9-2)26-20/h10,12,18H,8-9,11H2,1-7H3/b13-10+/t12-,18+,20?/m0/s1 |
| InChIKey | LVCZQMMHPNOACI-WBTMUPGWSA-N |
| XLogP | 3.50 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|