About [6,6-dimethyl-3-(2-methyloctan-2-yl)benzo[c]chromen-9-yl]methanol
[6,6-dimethyl-3-(2-methyloctan-2-yl)benzo[c]chromen-9-yl]methanol (PubChem CID 10546891) has the molecular formula C25H34O2
and a molecular weight of 366.55 g/mol. Its IUPAC name is [6,6-dimethyl-3-(2-methyloctan-2-yl)benzo[c]chromen-9-yl]methanol.
Molecular Properties
| Compound Name | [6,6-dimethyl-3-(2-methyloctan-2-yl)benzo[c]chromen-9-yl]methanol |
| PubChem CID | 10546891 |
| Molecular Formula | C25H34O2 |
| Molecular Weight | 366.55 g/mol |
| Exact Mass | 366.26 |
| IUPAC Name | [6,6-dimethyl-3-(2-methyloctan-2-yl)benzo[c]chromen-9-yl]methanol |
| SMILES | CCCCCCC(C)(C)c1ccc2c(c1)OC(C)(C)c1ccc(CO)cc1-2 |
| InChI | InChI=1S/C25H34O2/c1-6-7-8-9-14-24(2,3)19-11-12-20-21-15-18(17-26)10-13-22(21)25(4,5)27-23(20)16-19/h10-13,15-16,26H,6-9,14,17H2,1-5H3 |
| InChIKey | CFQBPYBPMFYBLY-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.55 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [6,6-dimethyl-3-(2-methyloctan-2-yl)benzo[c]chromen-9-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6,6-dimethyl-3-(2-methyloctan-2-yl)benzo[c]chromen-9-yl]methanol?
The IUPAC name of [6,6-dimethyl-3-(2-methyloctan-2-yl)benzo[c]chromen-9-yl]methanol (CID 10546891) is [6,6-dimethyl-3-(2-methyloctan-2-yl)benzo[c]chromen-9-yl]methanol.
What is the SMILES notation for [6,6-dimethyl-3-(2-methyloctan-2-yl)benzo[c]chromen-9-yl]methanol?
The canonical SMILES for [6,6-dimethyl-3-(2-methyloctan-2-yl)benzo[c]chromen-9-yl]methanol is CCCCCCC(C)(C)c1ccc2c(c1)OC(C)(C)c1ccc(CO)cc1-2.
What is the InChIKey of [6,6-dimethyl-3-(2-methyloctan-2-yl)benzo[c]chromen-9-yl]methanol?
The InChIKey is CFQBPYBPMFYBLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H34O2/c1-6-7-8-9-14-24(2,3)19-11-12-20-21-15-18(17-26)10-13-22(21)25(4,5)27-23(20)16-19/h10-13,15-16,26H,6-9,14,17H2,1-5H3.
What are the key properties of [6,6-dimethyl-3-(2-methyloctan-2-yl)benzo[c]chromen-9-yl]methanol?
[6,6-dimethyl-3-(2-methyloctan-2-yl)benzo[c]chromen-9-yl]methanol has a molecular weight of 366.55 g/mol, XLogP of 6.72, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [6,6-dimethyl-3-(2-methyloctan-2-yl)benzo[c]chromen-9-yl]methanol is sourced from PubChem (CID 10546891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).