About 3-cycloheptyl-3-fluoro-2,2-dimethylbutan-1-amine
3-cycloheptyl-3-fluoro-2,2-dimethylbutan-1-amine (PubChem CID 105469223) has the molecular formula C13H26FN
and a molecular weight of 215.36 g/mol. Its IUPAC name is 3-cycloheptyl-3-fluoro-2,2-dimethylbutan-1-amine.
Molecular Properties
| Compound Name | 3-cycloheptyl-3-fluoro-2,2-dimethylbutan-1-amine |
| PubChem CID | 105469223 |
| Molecular Formula | C13H26FN |
| Molecular Weight | 215.36 g/mol |
| Exact Mass | 215.20 |
| IUPAC Name | 3-cycloheptyl-3-fluoro-2,2-dimethylbutan-1-amine |
| SMILES | CC(C)(CN)C(C)(F)C1CCCCCC1 |
| InChI | InChI=1S/C13H26FN/c1-12(2,10-15)13(3,14)11-8-6-4-5-7-9-11/h11H,4-10,15H2,1-3H3 |
| InChIKey | XWRXAFXQYKEHDL-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.36 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-cycloheptyl-3-fluoro-2,2-dimethylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cycloheptyl-3-fluoro-2,2-dimethylbutan-1-amine?
The IUPAC name of 3-cycloheptyl-3-fluoro-2,2-dimethylbutan-1-amine (CID 105469223) is 3-cycloheptyl-3-fluoro-2,2-dimethylbutan-1-amine.
What is the SMILES notation for 3-cycloheptyl-3-fluoro-2,2-dimethylbutan-1-amine?
The canonical SMILES for 3-cycloheptyl-3-fluoro-2,2-dimethylbutan-1-amine is CC(C)(CN)C(C)(F)C1CCCCCC1.
What is the InChIKey of 3-cycloheptyl-3-fluoro-2,2-dimethylbutan-1-amine?
The InChIKey is XWRXAFXQYKEHDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26FN/c1-12(2,10-15)13(3,14)11-8-6-4-5-7-9-11/h11H,4-10,15H2,1-3H3.
What are the key properties of 3-cycloheptyl-3-fluoro-2,2-dimethylbutan-1-amine?
3-cycloheptyl-3-fluoro-2,2-dimethylbutan-1-amine has a molecular weight of 215.36 g/mol, XLogP of 3.67, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cycloheptyl-3-fluoro-2,2-dimethylbutan-1-amine is sourced from PubChem (CID 105469223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).