C14H20N2 — CID 105470355
(9-methyl-1,2,3,3a,4,5-hexahydropyrrolo[1,2-a]quinolin-2-yl)methanamine (PubChem CID 105470355) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is (9-methyl-1,2,3,3a,4,5-hexahydropyrrolo[1,2-a]quinolin-2-yl)methanamine.
| Compound Name | (9-methyl-1,2,3,3a,4,5-hexahydropyrrolo[1,2-a]quinolin-2-yl)methanamine |
|---|---|
| PubChem CID | 105470355 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | (9-methyl-1,2,3,3a,4,5-hexahydropyrrolo[1,2-a]quinolin-2-yl)methanamine |
| SMILES | Cc1cccc2c1N1CC(CN)CC1CC2 |
| InChI | InChI=1S/C14H20N2/c1-10-3-2-4-12-5-6-13-7-11(8-15)9-16(13)14(10)12/h2-4,11,13H,5-9,15H2,1H3 |
| InChIKey | GCOWUTMEPCDCOQ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |