About 2-[4-[2-(3,5-dimethylanilino)-2-oxoethyl]phenoxy]hexanoic acid
2-[4-[2-(3,5-dimethylanilino)-2-oxoethyl]phenoxy]hexanoic acid (PubChem CID 10547079) has the molecular formula C22H27NO4
and a molecular weight of 369.46 g/mol. Its IUPAC name is 2-[4-[2-(3,5-dimethylanilino)-2-oxoethyl]phenoxy]hexanoic acid.
Molecular Properties
| Compound Name | 2-[4-[2-(3,5-dimethylanilino)-2-oxoethyl]phenoxy]hexanoic acid |
| PubChem CID | 10547079 |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | 2-[4-[2-(3,5-dimethylanilino)-2-oxoethyl]phenoxy]hexanoic acid |
| SMILES | CCCCC(Oc1ccc(CC(=O)Nc2cc(C)cc(C)c2)cc1)C(=O)O |
| InChI | InChI=1S/C22H27NO4/c1-4-5-6-20(22(25)26)27-19-9-7-17(8-10-19)14-21(24)23-18-12-15(2)11-16(3)13-18/h7-13,20H,4-6,14H2,1-3H3,(H,23,24)(H,25,26) |
| InChIKey | ZBRSPXQWNWUBRN-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[4-[2-(3,5-dimethylanilino)-2-oxoethyl]phenoxy]hexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[2-(3,5-dimethylanilino)-2-oxoethyl]phenoxy]hexanoic acid?
The IUPAC name of 2-[4-[2-(3,5-dimethylanilino)-2-oxoethyl]phenoxy]hexanoic acid (CID 10547079) is 2-[4-[2-(3,5-dimethylanilino)-2-oxoethyl]phenoxy]hexanoic acid.
What is the SMILES notation for 2-[4-[2-(3,5-dimethylanilino)-2-oxoethyl]phenoxy]hexanoic acid?
The canonical SMILES for 2-[4-[2-(3,5-dimethylanilino)-2-oxoethyl]phenoxy]hexanoic acid is CCCCC(Oc1ccc(CC(=O)Nc2cc(C)cc(C)c2)cc1)C(=O)O.
What is the InChIKey of 2-[4-[2-(3,5-dimethylanilino)-2-oxoethyl]phenoxy]hexanoic acid?
The InChIKey is ZBRSPXQWNWUBRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27NO4/c1-4-5-6-20(22(25)26)27-19-9-7-17(8-10-19)14-21(24)23-18-12-15(2)11-16(3)13-18/h7-13,20H,4-6,14H2,1-3H3,(H,23,24)(H,25,26).
What are the key properties of 2-[4-[2-(3,5-dimethylanilino)-2-oxoethyl]phenoxy]hexanoic acid?
2-[4-[2-(3,5-dimethylanilino)-2-oxoethyl]phenoxy]hexanoic acid has a molecular weight of 369.46 g/mol, XLogP of 4.51, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[2-(3,5-dimethylanilino)-2-oxoethyl]phenoxy]hexanoic acid is sourced from PubChem (CID 10547079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).