C17H11FN4O3S — CID 10547117
6-(4-fluorophenyl)-2-(4-methoxyphenyl)-5-sulfanylidene-[1,3,4]oxadiazolo[3,2-a][1,3,5]triazin-7-one (PubChem CID 10547117) has the molecular formula C17H11FN4O3S and a molecular weight of 370.37 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-2-(4-methoxyphenyl)-5-sulfanylidene-[1,3,4]oxadiazolo[3,2-a][1,3,5]triazin-7-one.
| Compound Name | 6-(4-fluorophenyl)-2-(4-methoxyphenyl)-5-sulfanylidene-[1,3,4]oxadiazolo[3,2-a][1,3,5]triazin-7-one |
|---|---|
| PubChem CID | 10547117 |
| Molecular Formula | C17H11FN4O3S |
| Molecular Weight | 370.37 g/mol |
| Exact Mass | 370.05 |
| IUPAC Name | 6-(4-fluorophenyl)-2-(4-methoxyphenyl)-5-sulfanylidene-[1,3,4]oxadiazolo[3,2-a][1,3,5]triazin-7-one |
| SMILES | COc1ccc(-c2nn3c(=S)n(-c4ccc(F)cc4)c(=O)nc3o2)cc1 |
| InChI | InChI=1S/C17H11FN4O3S/c1-24-13-8-2-10(3-9-13)14-20-22-16(25-14)19-15(23)21(17(22)26)12-6-4-11(18)5-7-12/h2-9H,1H3 |
| InChIKey | NQRFIESRYBWQRM-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 74.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.37 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|