About 8-methylspiro[2,3-dihydrochromene-4,2'-cyclopropane]-1'-carboxylic acid
8-methylspiro[2,3-dihydrochromene-4,2'-cyclopropane]-1'-carboxylic acid (PubChem CID 105472206) has the molecular formula C13H14O3
and a molecular weight of 218.25 g/mol. Its IUPAC name is 8-methylspiro[2,3-dihydrochromene-4,2'-cyclopropane]-1'-carboxylic acid.
Molecular Properties
| Compound Name | 8-methylspiro[2,3-dihydrochromene-4,2'-cyclopropane]-1'-carboxylic acid |
| PubChem CID | 105472206 |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 8-methylspiro[2,3-dihydrochromene-4,2'-cyclopropane]-1'-carboxylic acid |
| SMILES | Cc1cccc2c1OCCC21CC1C(=O)O |
| InChI | InChI=1S/C13H14O3/c1-8-3-2-4-9-11(8)16-6-5-13(9)7-10(13)12(14)15/h2-4,10H,5-7H2,1H3,(H,14,15) |
| InChIKey | TUTDOWPYZCNRLD-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-methylspiro[2,3-dihydrochromene-4,2'-cyclopropane]-1'-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methylspiro[2,3-dihydrochromene-4,2'-cyclopropane]-1'-carboxylic acid?
The IUPAC name of 8-methylspiro[2,3-dihydrochromene-4,2'-cyclopropane]-1'-carboxylic acid (CID 105472206) is 8-methylspiro[2,3-dihydrochromene-4,2'-cyclopropane]-1'-carboxylic acid.
What is the SMILES notation for 8-methylspiro[2,3-dihydrochromene-4,2'-cyclopropane]-1'-carboxylic acid?
The canonical SMILES for 8-methylspiro[2,3-dihydrochromene-4,2'-cyclopropane]-1'-carboxylic acid is Cc1cccc2c1OCCC21CC1C(=O)O.
What is the InChIKey of 8-methylspiro[2,3-dihydrochromene-4,2'-cyclopropane]-1'-carboxylic acid?
The InChIKey is TUTDOWPYZCNRLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14O3/c1-8-3-2-4-9-11(8)16-6-5-13(9)7-10(13)12(14)15/h2-4,10H,5-7H2,1H3,(H,14,15).
What are the key properties of 8-methylspiro[2,3-dihydrochromene-4,2'-cyclopropane]-1'-carboxylic acid?
8-methylspiro[2,3-dihydrochromene-4,2'-cyclopropane]-1'-carboxylic acid has a molecular weight of 218.25 g/mol, XLogP of 2.12, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methylspiro[2,3-dihydrochromene-4,2'-cyclopropane]-1'-carboxylic acid is sourced from PubChem (CID 105472206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).