About 7-(4-hydroxyphenyl)-5,7-diazaspiro[3.4]octan-6-one
7-(4-hydroxyphenyl)-5,7-diazaspiro[3.4]octan-6-one (PubChem CID 105472260) has the molecular formula C12H14N2O2
and a molecular weight of 218.26 g/mol. Its IUPAC name is 7-(4-hydroxyphenyl)-5,7-diazaspiro[3.4]octan-6-one.
Molecular Properties
| Compound Name | 7-(4-hydroxyphenyl)-5,7-diazaspiro[3.4]octan-6-one |
| PubChem CID | 105472260 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 7-(4-hydroxyphenyl)-5,7-diazaspiro[3.4]octan-6-one |
| SMILES | O=C1NC2(CCC2)CN1c1ccc(O)cc1 |
| InChI | InChI=1S/C12H14N2O2/c15-10-4-2-9(3-5-10)14-8-12(6-1-7-12)13-11(14)16/h2-5,15H,1,6-8H2,(H,13,16) |
| InChIKey | KVTXGUNWQYEOMF-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-(4-hydroxyphenyl)-5,7-diazaspiro[3.4]octan-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(4-hydroxyphenyl)-5,7-diazaspiro[3.4]octan-6-one?
The IUPAC name of 7-(4-hydroxyphenyl)-5,7-diazaspiro[3.4]octan-6-one (CID 105472260) is 7-(4-hydroxyphenyl)-5,7-diazaspiro[3.4]octan-6-one.
What is the SMILES notation for 7-(4-hydroxyphenyl)-5,7-diazaspiro[3.4]octan-6-one?
The canonical SMILES for 7-(4-hydroxyphenyl)-5,7-diazaspiro[3.4]octan-6-one is O=C1NC2(CCC2)CN1c1ccc(O)cc1.
What is the InChIKey of 7-(4-hydroxyphenyl)-5,7-diazaspiro[3.4]octan-6-one?
The InChIKey is KVTXGUNWQYEOMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O2/c15-10-4-2-9(3-5-10)14-8-12(6-1-7-12)13-11(14)16/h2-5,15H,1,6-8H2,(H,13,16).
What are the key properties of 7-(4-hydroxyphenyl)-5,7-diazaspiro[3.4]octan-6-one?
7-(4-hydroxyphenyl)-5,7-diazaspiro[3.4]octan-6-one has a molecular weight of 218.26 g/mol, XLogP of 1.84, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(4-hydroxyphenyl)-5,7-diazaspiro[3.4]octan-6-one is sourced from PubChem (CID 105472260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).