C14H14Cl4O3 — CID 10547236
2-(2,3,5,6-tetrachloro-4-hydroxyphenoxy)cyclooctan-1-one (PubChem CID 10547236) has the molecular formula C14H14Cl4O3 and a molecular weight of 372.08 g/mol. Its IUPAC name is 2-(2,3,5,6-tetrachloro-4-hydroxyphenoxy)cyclooctan-1-one.
| Compound Name | 2-(2,3,5,6-tetrachloro-4-hydroxyphenoxy)cyclooctan-1-one |
|---|---|
| PubChem CID | 10547236 |
| Molecular Formula | C14H14Cl4O3 |
| Molecular Weight | 372.08 g/mol |
| Exact Mass | 369.97 |
| IUPAC Name | 2-(2,3,5,6-tetrachloro-4-hydroxyphenoxy)cyclooctan-1-one |
| SMILES | O=C1CCCCCCC1Oc1c(Cl)c(Cl)c(O)c(Cl)c1Cl |
| InChI | InChI=1S/C14H14Cl4O3/c15-9-11(17)14(12(18)10(16)13(9)20)21-8-6-4-2-1-3-5-7(8)19/h8,20H,1-6H2 |
| InChIKey | GEIAQTJEFSALRG-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.08 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|