About 1-ethoxy-7-phenyl-2,6-bis(trimethylsilyl)-4-oxaspiro[2.4]hepta-1,6-dien-5-one
1-ethoxy-7-phenyl-2,6-bis(trimethylsilyl)-4-oxaspiro[2.4]hepta-1,6-dien-5-one (PubChem CID 10547317) has the molecular formula C20H28O3Si2
and a molecular weight of 372.61 g/mol. Its IUPAC name is 1-ethoxy-7-phenyl-2,6-bis(trimethylsilyl)-4-oxaspiro[2.4]hepta-1,6-dien-5-one.
Molecular Properties
| Compound Name | 1-ethoxy-7-phenyl-2,6-bis(trimethylsilyl)-4-oxaspiro[2.4]hepta-1,6-dien-5-one |
| PubChem CID | 10547317 |
| Molecular Formula | C20H28O3Si2 |
| Molecular Weight | 372.61 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 1-ethoxy-7-phenyl-2,6-bis(trimethylsilyl)-4-oxaspiro[2.4]hepta-1,6-dien-5-one |
| SMILES | CCOC1=C([Si](C)(C)C)C12OC(=O)C([Si](C)(C)C)=C2c1ccccc1 |
| InChI | InChI=1S/C20H28O3Si2/c1-8-22-17-18(25(5,6)7)20(17)15(14-12-10-9-11-13-14)16(19(21)23-20)24(2,3)4/h9-13H,8H2,1-7H3 |
| InChIKey | KHGAWDBLWNNXED-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.61 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-ethoxy-7-phenyl-2,6-bis(trimethylsilyl)-4-oxaspiro[2.4]hepta-1,6-dien-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethoxy-7-phenyl-2,6-bis(trimethylsilyl)-4-oxaspiro[2.4]hepta-1,6-dien-5-one?
The IUPAC name of 1-ethoxy-7-phenyl-2,6-bis(trimethylsilyl)-4-oxaspiro[2.4]hepta-1,6-dien-5-one (CID 10547317) is 1-ethoxy-7-phenyl-2,6-bis(trimethylsilyl)-4-oxaspiro[2.4]hepta-1,6-dien-5-one.
What is the SMILES notation for 1-ethoxy-7-phenyl-2,6-bis(trimethylsilyl)-4-oxaspiro[2.4]hepta-1,6-dien-5-one?
The canonical SMILES for 1-ethoxy-7-phenyl-2,6-bis(trimethylsilyl)-4-oxaspiro[2.4]hepta-1,6-dien-5-one is CCOC1=C([Si](C)(C)C)C12OC(=O)C([Si](C)(C)C)=C2c1ccccc1.
What is the InChIKey of 1-ethoxy-7-phenyl-2,6-bis(trimethylsilyl)-4-oxaspiro[2.4]hepta-1,6-dien-5-one?
The InChIKey is KHGAWDBLWNNXED-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H28O3Si2/c1-8-22-17-18(25(5,6)7)20(17)15(14-12-10-9-11-13-14)16(19(21)23-20)24(2,3)4/h9-13H,8H2,1-7H3.
What are the key properties of 1-ethoxy-7-phenyl-2,6-bis(trimethylsilyl)-4-oxaspiro[2.4]hepta-1,6-dien-5-one?
1-ethoxy-7-phenyl-2,6-bis(trimethylsilyl)-4-oxaspiro[2.4]hepta-1,6-dien-5-one has a molecular weight of 372.61 g/mol, XLogP of 4.79, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethoxy-7-phenyl-2,6-bis(trimethylsilyl)-4-oxaspiro[2.4]hepta-1,6-dien-5-one is sourced from PubChem (CID 10547317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).