C9H18N2O2S — CID 105473181
(1,1-dioxo-3-piperidin-1-ylthietan-3-yl)methanamine (PubChem CID 105473181) has the molecular formula C9H18N2O2S and a molecular weight of 218.32 g/mol. Its IUPAC name is (1,1-dioxo-3-piperidin-1-ylthietan-3-yl)methanamine.
| Compound Name | (1,1-dioxo-3-piperidin-1-ylthietan-3-yl)methanamine |
|---|---|
| PubChem CID | 105473181 |
| Molecular Formula | C9H18N2O2S |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | (1,1-dioxo-3-piperidin-1-ylthietan-3-yl)methanamine |
| SMILES | NCC1(N2CCCCC2)CS(=O)(=O)C1 |
| InChI | InChI=1S/C9H18N2O2S/c10-6-9(7-14(12,13)8-9)11-4-2-1-3-5-11/h1-8,10H2 |
| InChIKey | CWXJNSDQEKCISD-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |