About 2-(5-propan-2-yl-1,3-thiazol-4-yl)aniline
2-(5-propan-2-yl-1,3-thiazol-4-yl)aniline (PubChem CID 105473203) has the molecular formula C12H14N2S
and a molecular weight of 218.32 g/mol. Its IUPAC name is 2-(5-propan-2-yl-1,3-thiazol-4-yl)aniline.
Molecular Properties
| Compound Name | 2-(5-propan-2-yl-1,3-thiazol-4-yl)aniline |
| PubChem CID | 105473203 |
| Molecular Formula | C12H14N2S |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 2-(5-propan-2-yl-1,3-thiazol-4-yl)aniline |
| SMILES | CC(C)c1scnc1-c1ccccc1N |
| InChI | InChI=1S/C12H14N2S/c1-8(2)12-11(14-7-15-12)9-5-3-4-6-10(9)13/h3-8H,13H2,1-2H3 |
| InChIKey | FZPZEZPDUPCUOK-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(5-propan-2-yl-1,3-thiazol-4-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-propan-2-yl-1,3-thiazol-4-yl)aniline?
The IUPAC name of 2-(5-propan-2-yl-1,3-thiazol-4-yl)aniline (CID 105473203) is 2-(5-propan-2-yl-1,3-thiazol-4-yl)aniline.
What is the SMILES notation for 2-(5-propan-2-yl-1,3-thiazol-4-yl)aniline?
The canonical SMILES for 2-(5-propan-2-yl-1,3-thiazol-4-yl)aniline is CC(C)c1scnc1-c1ccccc1N.
What is the InChIKey of 2-(5-propan-2-yl-1,3-thiazol-4-yl)aniline?
The InChIKey is FZPZEZPDUPCUOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2S/c1-8(2)12-11(14-7-15-12)9-5-3-4-6-10(9)13/h3-8H,13H2,1-2H3.
What are the key properties of 2-(5-propan-2-yl-1,3-thiazol-4-yl)aniline?
2-(5-propan-2-yl-1,3-thiazol-4-yl)aniline has a molecular weight of 218.32 g/mol, XLogP of 3.52, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-propan-2-yl-1,3-thiazol-4-yl)aniline is sourced from PubChem (CID 105473203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).