C12H13NO3 — CID 105473783
1-(2-methylpropyl)-3-oxo-2,1-benzoxazole-4-carbaldehyde (PubChem CID 105473783) has the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. Its IUPAC name is 1-(2-methylpropyl)-3-oxo-2,1-benzoxazole-4-carbaldehyde.
| Compound Name | 1-(2-methylpropyl)-3-oxo-2,1-benzoxazole-4-carbaldehyde |
|---|---|
| PubChem CID | 105473783 |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 1-(2-methylpropyl)-3-oxo-2,1-benzoxazole-4-carbaldehyde |
| SMILES | CC(C)Cn1oc(=O)c2c(C=O)cccc21 |
| InChI | InChI=1S/C12H13NO3/c1-8(2)6-13-10-5-3-4-9(7-14)11(10)12(15)16-13/h3-5,7-8H,6H2,1-2H3 |
| InChIKey | CLKYHDVNUWQDDK-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 52.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|