C10H13N5O — CID 105473879
5-piperidin-4-yl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one (PubChem CID 105473879) has the molecular formula C10H13N5O and a molecular weight of 219.25 g/mol. Its IUPAC name is 5-piperidin-4-yl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one.
| Compound Name | 5-piperidin-4-yl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 105473879 |
| Molecular Formula | C10H13N5O |
| Molecular Weight | 219.25 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | 5-piperidin-4-yl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
| SMILES | O=c1cc(C2CCNCC2)nc2nc[nH]n12 |
| InChI | InChI=1S/C10H13N5O/c16-9-5-8(7-1-3-11-4-2-7)14-10-12-6-13-15(9)10/h5-7,11H,1-4H2,(H,12,13,14) |
| InChIKey | CAAJYAPHTLSDCO-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.25 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |