About 2-(1-tert-butylpiperidin-3-yl)-2,2-difluoroacetaldehyde
2-(1-tert-butylpiperidin-3-yl)-2,2-difluoroacetaldehyde (PubChem CID 105474078) has the molecular formula C11H19F2NO
and a molecular weight of 219.27 g/mol. Its IUPAC name is 2-(1-tert-butylpiperidin-3-yl)-2,2-difluoroacetaldehyde.
Molecular Properties
| Compound Name | 2-(1-tert-butylpiperidin-3-yl)-2,2-difluoroacetaldehyde |
| PubChem CID | 105474078 |
| Molecular Formula | C11H19F2NO |
| Molecular Weight | 219.27 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | 2-(1-tert-butylpiperidin-3-yl)-2,2-difluoroacetaldehyde |
| SMILES | CC(C)(C)N1CCCC(C(F)(F)C=O)C1 |
| InChI | InChI=1S/C11H19F2NO/c1-10(2,3)14-6-4-5-9(7-14)11(12,13)8-15/h8-9H,4-7H2,1-3H3 |
| InChIKey | UMPOIIOBDOAFBU-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.27 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-tert-butylpiperidin-3-yl)-2,2-difluoroacetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-tert-butylpiperidin-3-yl)-2,2-difluoroacetaldehyde?
The IUPAC name of 2-(1-tert-butylpiperidin-3-yl)-2,2-difluoroacetaldehyde (CID 105474078) is 2-(1-tert-butylpiperidin-3-yl)-2,2-difluoroacetaldehyde.
What is the SMILES notation for 2-(1-tert-butylpiperidin-3-yl)-2,2-difluoroacetaldehyde?
The canonical SMILES for 2-(1-tert-butylpiperidin-3-yl)-2,2-difluoroacetaldehyde is CC(C)(C)N1CCCC(C(F)(F)C=O)C1.
What is the InChIKey of 2-(1-tert-butylpiperidin-3-yl)-2,2-difluoroacetaldehyde?
The InChIKey is UMPOIIOBDOAFBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19F2NO/c1-10(2,3)14-6-4-5-9(7-14)11(12,13)8-15/h8-9H,4-7H2,1-3H3.
What are the key properties of 2-(1-tert-butylpiperidin-3-yl)-2,2-difluoroacetaldehyde?
2-(1-tert-butylpiperidin-3-yl)-2,2-difluoroacetaldehyde has a molecular weight of 219.27 g/mol, XLogP of 2.33, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-tert-butylpiperidin-3-yl)-2,2-difluoroacetaldehyde is sourced from PubChem (CID 105474078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).