C25H42O2 — CID 10547449
(Z,6R)-pentacos-16-en-2,4-diyne-1,6-diol (PubChem CID 10547449) has the molecular formula C25H42O2 and a molecular weight of 374.61 g/mol. Its IUPAC name is (Z,6R)-pentacos-16-en-2,4-diyne-1,6-diol.
| Compound Name | (Z,6R)-pentacos-16-en-2,4-diyne-1,6-diol |
|---|---|
| PubChem CID | 10547449 |
| Molecular Formula | C25H42O2 |
| Molecular Weight | 374.61 g/mol |
| Exact Mass | 374.32 |
| IUPAC Name | (Z,6R)-pentacos-16-en-2,4-diyne-1,6-diol |
| SMILES | CCCCCCCC/C=C\CCCCCCCCC[C@@H](O)C#CC#CCO |
| InChI | InChI=1S/C25H42O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19-22-25(27)23-20-18-21-24-26/h9-10,25-27H,2-8,11-17,19,22,24H2,1H3/b10-9-/t25-/m1/s1 |
| InChIKey | NKDFAYUSKHUVJW-HAAQQRBASA-N |
| XLogP | 6.16 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.61 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|