About 3-(aminomethyl)-4,6-dimethyl-1-(trifluoromethyl)pyridin-2-one
3-(aminomethyl)-4,6-dimethyl-1-(trifluoromethyl)pyridin-2-one (PubChem CID 105475195) has the molecular formula C9H11F3N2O
and a molecular weight of 220.19 g/mol. Its IUPAC name is 3-(aminomethyl)-4,6-dimethyl-1-(trifluoromethyl)pyridin-2-one.
Molecular Properties
| Compound Name | 3-(aminomethyl)-4,6-dimethyl-1-(trifluoromethyl)pyridin-2-one |
| PubChem CID | 105475195 |
| Molecular Formula | C9H11F3N2O |
| Molecular Weight | 220.19 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 3-(aminomethyl)-4,6-dimethyl-1-(trifluoromethyl)pyridin-2-one |
| SMILES | Cc1cc(C)n(C(F)(F)F)c(=O)c1CN |
| InChI | InChI=1S/C9H11F3N2O/c1-5-3-6(2)14(9(10,11)12)8(15)7(5)4-13/h3H,4,13H2,1-2H3 |
| InChIKey | UYIYMYWITZKDAO-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.19 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(aminomethyl)-4,6-dimethyl-1-(trifluoromethyl)pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(aminomethyl)-4,6-dimethyl-1-(trifluoromethyl)pyridin-2-one?
The IUPAC name of 3-(aminomethyl)-4,6-dimethyl-1-(trifluoromethyl)pyridin-2-one (CID 105475195) is 3-(aminomethyl)-4,6-dimethyl-1-(trifluoromethyl)pyridin-2-one.
What is the SMILES notation for 3-(aminomethyl)-4,6-dimethyl-1-(trifluoromethyl)pyridin-2-one?
The canonical SMILES for 3-(aminomethyl)-4,6-dimethyl-1-(trifluoromethyl)pyridin-2-one is Cc1cc(C)n(C(F)(F)F)c(=O)c1CN.
What is the InChIKey of 3-(aminomethyl)-4,6-dimethyl-1-(trifluoromethyl)pyridin-2-one?
The InChIKey is UYIYMYWITZKDAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11F3N2O/c1-5-3-6(2)14(9(10,11)12)8(15)7(5)4-13/h3H,4,13H2,1-2H3.
What are the key properties of 3-(aminomethyl)-4,6-dimethyl-1-(trifluoromethyl)pyridin-2-one?
3-(aminomethyl)-4,6-dimethyl-1-(trifluoromethyl)pyridin-2-one has a molecular weight of 220.19 g/mol, XLogP of 1.40, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(aminomethyl)-4,6-dimethyl-1-(trifluoromethyl)pyridin-2-one is sourced from PubChem (CID 105475195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).