C23H36O4 — CID 10547569
(4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-10-oct-1-ynyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane (PubChem CID 10547569) has the molecular formula C23H36O4 and a molecular weight of 376.54 g/mol. Its IUPAC name is (4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-10-oct-1-ynyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane.
| Compound Name | (4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-10-oct-1-ynyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane |
|---|---|
| PubChem CID | 10547569 |
| Molecular Formula | C23H36O4 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.26 |
| IUPAC Name | (4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-10-oct-1-ynyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane |
| SMILES | CCCCCCC#C[C@H]1O[C@@H]2OC3(C)CC[C@H]4[C@H](C)CC[C@@H]([C@H]1C)[C@@]24OO3 |
| InChI | InChI=1S/C23H36O4/c1-5-6-7-8-9-10-11-20-17(3)19-13-12-16(2)18-14-15-22(4)25-21(24-20)23(18,19)27-26-22/h16-21H,5-9,12-15H2,1-4H3/t16-,17-,18+,19+,20-,21-,22?,23-/m1/s1 |
| InChIKey | VWLGIEKTJWRVOC-HJUPAYLLSA-N |
| XLogP | 5.21 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|