About 1-tert-butyl-6-hydroxy-3,4-dihydroquinoxalin-2-one
1-tert-butyl-6-hydroxy-3,4-dihydroquinoxalin-2-one (PubChem CID 105475882) has the molecular formula C12H16N2O2
and a molecular weight of 220.27 g/mol. Its IUPAC name is 1-tert-butyl-6-hydroxy-3,4-dihydroquinoxalin-2-one.
Molecular Properties
| Compound Name | 1-tert-butyl-6-hydroxy-3,4-dihydroquinoxalin-2-one |
| PubChem CID | 105475882 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 1-tert-butyl-6-hydroxy-3,4-dihydroquinoxalin-2-one |
| SMILES | CC(C)(C)N1C(=O)CNc2cc(O)ccc21 |
| InChI | InChI=1S/C12H16N2O2/c1-12(2,3)14-10-5-4-8(15)6-9(10)13-7-11(14)16/h4-6,13,15H,7H2,1-3H3 |
| InChIKey | GGQKVIDZMIYZPX-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-tert-butyl-6-hydroxy-3,4-dihydroquinoxalin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-6-hydroxy-3,4-dihydroquinoxalin-2-one?
The IUPAC name of 1-tert-butyl-6-hydroxy-3,4-dihydroquinoxalin-2-one (CID 105475882) is 1-tert-butyl-6-hydroxy-3,4-dihydroquinoxalin-2-one.
What is the SMILES notation for 1-tert-butyl-6-hydroxy-3,4-dihydroquinoxalin-2-one?
The canonical SMILES for 1-tert-butyl-6-hydroxy-3,4-dihydroquinoxalin-2-one is CC(C)(C)N1C(=O)CNc2cc(O)ccc21.
What is the InChIKey of 1-tert-butyl-6-hydroxy-3,4-dihydroquinoxalin-2-one?
The InChIKey is GGQKVIDZMIYZPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O2/c1-12(2,3)14-10-5-4-8(15)6-9(10)13-7-11(14)16/h4-6,13,15H,7H2,1-3H3.
What are the key properties of 1-tert-butyl-6-hydroxy-3,4-dihydroquinoxalin-2-one?
1-tert-butyl-6-hydroxy-3,4-dihydroquinoxalin-2-one has a molecular weight of 220.27 g/mol, XLogP of 1.95, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-6-hydroxy-3,4-dihydroquinoxalin-2-one is sourced from PubChem (CID 105475882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).